C22H22N4O8 — CID 18937742
ethyl 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (PubChem CID 18937742) has the molecular formula C22H22N4O8 and a molecular weight of 470.44 g/mol. Its IUPAC name is ethyl 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 18937742 |
| Molecular Formula | C22H22N4O8 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | ethyl 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)c2cc(OCOC)ccc2[N+](=O)[O-])nnn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H22N4O8/c1-4-33-22(28)20-19(23-24-25(20)12-14-5-7-15(32-3)8-6-14)21(27)17-11-16(34-13-31-2)9-10-18(17)26(29)30/h5-11H,4,12-13H2,1-3H3 |
| InChIKey | YBMFLJDIPIUPGR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 144.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|