C21H18N4O8 — CID 18697796
ethyl 1-[(4-methoxyphenyl)methyl]-5-(6-nitro-1,3-benzodioxole-5-carbonyl)triazole-4-carboxylate (PubChem CID 18697796) has the molecular formula C21H18N4O8 and a molecular weight of 454.40 g/mol. Its IUPAC name is ethyl 1-[(4-methoxyphenyl)methyl]-5-(6-nitro-1,3-benzodioxole-5-carbonyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-[(4-methoxyphenyl)methyl]-5-(6-nitro-1,3-benzodioxole-5-carbonyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 18697796 |
| Molecular Formula | C21H18N4O8 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | ethyl 1-[(4-methoxyphenyl)methyl]-5-(6-nitro-1,3-benzodioxole-5-carbonyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ccc(OC)cc2)c1C(=O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C21H18N4O8/c1-3-31-21(27)18-19(24(23-22-18)10-12-4-6-13(30-2)7-5-12)20(26)14-8-16-17(33-11-32-16)9-15(14)25(28)29/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | YCWITWRJUVCTLZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 144.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|