C37H35N5O8 — CID 70268186
ethyl 5-[3-benzamido-2-nitro-4-(4-phenylbutoxy)benzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (PubChem CID 70268186) has the molecular formula C37H35N5O8 and a molecular weight of 677.71 g/mol. Its IUPAC name is ethyl 5-[3-benzamido-2-nitro-4-(4-phenylbutoxy)benzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-benzamido-2-nitro-4-(4-phenylbutoxy)benzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 70268186 |
| Molecular Formula | C37H35N5O8 |
| Molecular Weight | 677.71 g/mol |
| Exact Mass | 677.25 |
| IUPAC Name | ethyl 5-[3-benzamido-2-nitro-4-(4-phenylbutoxy)benzoyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)c2ccc(OCCCCc3ccccc3)c(NC(=O)c3ccccc3)c2[N+](=O)[O-])nnn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C37H35N5O8/c1-3-49-37(45)34-32(39-40-41(34)24-26-17-19-28(48-2)20-18-26)35(43)29-21-22-30(50-23-11-10-14-25-12-6-4-7-13-25)31(33(29)42(46)47)38-36(44)27-15-8-5-9-16-27/h4-9,12-13,15-22H,3,10-11,14,23-24H2,1-2H3,(H,38,44) |
| InChIKey | HBOJMTOVZMBZKY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 164.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|