C15H15N3O7 — CID 169191319
dimethyl 1-[(4-methoxyphenyl)methyl]-4-nitropyrazole-3,5-dicarboxylate (PubChem CID 169191319) has the molecular formula C15H15N3O7 and a molecular weight of 349.30 g/mol. Its IUPAC name is dimethyl 1-[(4-methoxyphenyl)methyl]-4-nitropyrazole-3,5-dicarboxylate.
| Compound Name | dimethyl 1-[(4-methoxyphenyl)methyl]-4-nitropyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 169191319 |
| Molecular Formula | C15H15N3O7 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | dimethyl 1-[(4-methoxyphenyl)methyl]-4-nitropyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1nn(Cc2ccc(OC)cc2)c(C(=O)OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O7/c1-23-10-6-4-9(5-7-10)8-17-13(15(20)25-3)12(18(21)22)11(16-17)14(19)24-2/h4-7H,8H2,1-3H3 |
| InChIKey | ORCIKGWLMMZXSM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 122.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|