C13H13ClN2O5S — CID 167348254
methyl 3-chlorosulfonyl-1-[(4-methoxyphenyl)methyl]pyrazole-5-carboxylate (PubChem CID 167348254) has the molecular formula C13H13ClN2O5S and a molecular weight of 344.78 g/mol. Its IUPAC name is methyl 3-chlorosulfonyl-1-[(4-methoxyphenyl)methyl]pyrazole-5-carboxylate.
| Compound Name | methyl 3-chlorosulfonyl-1-[(4-methoxyphenyl)methyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167348254 |
| Molecular Formula | C13H13ClN2O5S |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | methyl 3-chlorosulfonyl-1-[(4-methoxyphenyl)methyl]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Cl)nn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H13ClN2O5S/c1-20-10-5-3-9(4-6-10)8-16-11(13(17)21-2)7-12(15-16)22(14,18)19/h3-7H,8H2,1-2H3 |
| InChIKey | FPKHHWLYXZHAHU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |