C15H22N4O5S — CID 175014218
acetic acid;1-[(4-methoxyphenyl)methyl]-5-(methylaminomethyl)pyrazole-3-sulfonamide (PubChem CID 175014218) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is acetic acid;1-[(4-methoxyphenyl)methyl]-5-(methylaminomethyl)pyrazole-3-sulfonamide.
| Compound Name | acetic acid;1-[(4-methoxyphenyl)methyl]-5-(methylaminomethyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 175014218 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | acetic acid;1-[(4-methoxyphenyl)methyl]-5-(methylaminomethyl)pyrazole-3-sulfonamide |
| SMILES | CC(=O)O.CNCc1cc(S(N)(=O)=O)nn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H18N4O3S.C2H4O2/c1-15-8-11-7-13(21(14,18)19)16-17(11)9-10-3-5-12(20-2)6-4-10;1-2(3)4/h3-7,15H,8-9H2,1-2H3,(H2,14,18,19);1H3,(H,3,4) |
| InChIKey | YLQDSIOHYOOLSR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |