C15H13N3O4 — CID 91103764
dimethyl 1-[(4-cyanophenyl)methyl]pyrazole-3,5-dicarboxylate (PubChem CID 91103764) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is dimethyl 1-[(4-cyanophenyl)methyl]pyrazole-3,5-dicarboxylate.
| Compound Name | dimethyl 1-[(4-cyanophenyl)methyl]pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91103764 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | dimethyl 1-[(4-cyanophenyl)methyl]pyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)n(Cc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C15H13N3O4/c1-21-14(19)12-7-13(15(20)22-2)18(17-12)9-11-5-3-10(8-16)4-6-11/h3-7H,9H2,1-2H3 |
| InChIKey | RGOIHBYNFYVVKN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |