C15H16N2O5 — CID 159506500
carbon dioxide;methyl 1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-5-carboxylate (PubChem CID 159506500) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is carbon dioxide;methyl 1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-5-carboxylate.
| Compound Name | carbon dioxide;methyl 1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 159506500 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | carbon dioxide;methyl 1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(C)cnn1Cc1ccc(OC)cc1.O=C=O |
| InChI | InChI=1S/C14H16N2O3.CO2/c1-10-8-15-16(13(10)14(17)19-3)9-11-4-6-12(18-2)7-5-11;2-1-3/h4-8H,9H2,1-3H3; |
| InChIKey | MABCNKKPXUYVDR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |