C24H28N4O6 — CID 18697864
ethyl 5-(2-amino-4-methoxy-5-propan-2-yloxybenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (PubChem CID 18697864) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is ethyl 5-(2-amino-4-methoxy-5-propan-2-yloxybenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-amino-4-methoxy-5-propan-2-yloxybenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 18697864 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | ethyl 5-(2-amino-4-methoxy-5-propan-2-yloxybenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)c2cc(OC(C)C)c(OC)cc2N)nnn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H28N4O6/c1-6-33-24(30)22-21(26-27-28(22)13-15-7-9-16(31-4)10-8-15)23(29)17-11-20(34-14(2)3)19(32-5)12-18(17)25/h7-12,14H,6,13,25H2,1-5H3 |
| InChIKey | POKMYYKADJVPHG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|