C21H18BrNO3S3 — CID 139258109
5-[3-(5-bromothiophen-2-yl)-5-hexyl-4,6-dioxothieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde (PubChem CID 139258109) has the molecular formula C21H18BrNO3S3 and a molecular weight of 508.48 g/mol. Its IUPAC name is 5-[3-(5-bromothiophen-2-yl)-5-hexyl-4,6-dioxothieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-(5-bromothiophen-2-yl)-5-hexyl-4,6-dioxothieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139258109 |
| Molecular Formula | C21H18BrNO3S3 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 506.96 |
| IUPAC Name | 5-[3-(5-bromothiophen-2-yl)-5-hexyl-4,6-dioxothieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCN1C(=O)c2c(-c3ccc(Br)s3)sc(-c3ccc(C=O)s3)c2C1=O |
| InChI | InChI=1S/C21H18BrNO3S3/c1-2-3-4-5-10-23-20(25)16-17(21(23)26)19(14-8-9-15(22)28-14)29-18(16)13-7-6-12(11-24)27-13/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | NUBBYFYACOCRDW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|