C20H25NO2S2 — CID 71273443
1-methyl-3-(5-methylthiophen-2-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 71273443) has the molecular formula C20H25NO2S2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-methyl-3-(5-methylthiophen-2-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1-methyl-3-(5-methylthiophen-2-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 71273443 |
| Molecular Formula | C20H25NO2S2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-methyl-3-(5-methylthiophen-2-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2c(C)sc(-c3ccc(C)s3)c2C1=O |
| InChI | InChI=1S/C20H25NO2S2/c1-4-5-6-7-8-9-12-21-19(22)16-14(3)25-18(17(16)20(21)23)15-11-10-13(2)24-15/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | CNIPGHNYBMVGOP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|