C46H61NO2S3 — CID 58401191
3-[14,15-bis(2-ethylhexyl)-9-methyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 58401191) has the molecular formula C46H61NO2S3 and a molecular weight of 756.20 g/mol. Its IUPAC name is 3-[14,15-bis(2-ethylhexyl)-9-methyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-[14,15-bis(2-ethylhexyl)-9-methyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 58401191 |
| Molecular Formula | C46H61NO2S3 |
| Molecular Weight | 756.20 g/mol |
| Exact Mass | 755.39 |
| IUPAC Name | 3-[14,15-bis(2-ethylhexyl)-9-methyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2c(C)sc(-c3cc4c5cc(CC(CC)CCCC)c(CC(CC)CCCC)cc5c5cc(C)sc5c4s3)c2C1=O |
| InChI | InChI=1S/C46H61NO2S3/c1-8-13-16-17-18-19-22-47-45(48)40-30(7)51-44(41(40)46(47)49)39-28-38-36-27-34(25-32(12-5)21-15-10-3)33(24-31(11-4)20-14-9-2)26-35(36)37-23-29(6)50-42(37)43(38)52-39/h23,26-28,31-32H,8-22,24-25H2,1-7H3 |
| InChIKey | FRGHNYDJJNCROZ-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.20 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|