C55H79NO2S3 — CID 58401196
3-[7-(5,9-diethyltridecan-7-yl)-10-methyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-6,7-bis(2-ethylhexyl)-1-methylbenzo[f][2]benzothiole-4,9-dione (PubChem CID 58401196) has the molecular formula C55H79NO2S3 and a molecular weight of 882.44 g/mol. Its IUPAC name is 3-[7-(5,9-diethyltridecan-7-yl)-10-methyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-6,7-bis(2-ethylhexyl)-1-methylbenzo[f][2]benzothiole-4,9-dione.
| Compound Name | 3-[7-(5,9-diethyltridecan-7-yl)-10-methyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-6,7-bis(2-ethylhexyl)-1-methylbenzo[f][2]benzothiole-4,9-dione |
|---|---|
| PubChem CID | 58401196 |
| Molecular Formula | C55H79NO2S3 |
| Molecular Weight | 882.44 g/mol |
| Exact Mass | 881.53 |
| IUPAC Name | 3-[7-(5,9-diethyltridecan-7-yl)-10-methyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-6,7-bis(2-ethylhexyl)-1-methylbenzo[f][2]benzothiole-4,9-dione |
| SMILES | CCCCC(CC)Cc1cc2c(cc1CC(CC)CCCC)C(=O)c1c(-c3cc4c(s3)c3sc(C)cc3n4C(CC(CC)CCCC)CC(CC)CCCC)sc(C)c1C2=O |
| InChI | InChI=1S/C55H79NO2S3/c1-11-19-23-37(15-5)28-41-32-44-45(33-42(41)29-38(16-6)24-20-12-2)52(58)50-49(51(44)57)36(10)60-55(50)48-34-47-54(61-48)53-46(27-35(9)59-53)56(47)43(30-39(17-7)25-21-13-3)31-40(18-8)26-22-14-4/h27,32-34,37-40,43H,11-26,28-31H2,1-10H3 |
| InChIKey | SBFAKYVUULKEDS-UHFFFAOYSA-N |
| XLogP | 18.31 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.44 |
| LogP ≤ 5 | 18.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|