C41H59NO2S3 — CID 90361966
3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 90361966) has the molecular formula C41H59NO2S3 and a molecular weight of 694.13 g/mol. Its IUPAC name is 3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 90361966 |
| Molecular Formula | C41H59NO2S3 |
| Molecular Weight | 694.13 g/mol |
| Exact Mass | 693.37 |
| IUPAC Name | 3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-octylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2c(C)sc(-c3cc4c(s3)-c3sc(C)cc3C4(CC(CC)CCCC)CC(CC)CCCC)c2C1=O |
| InChI | InChI=1S/C41H59NO2S3/c1-8-13-16-17-18-19-22-42-39(43)34-28(7)46-38(35(34)40(42)44)33-24-32-37(47-33)36-31(23-27(6)45-36)41(32,25-29(11-4)20-14-9-2)26-30(12-5)21-15-10-3/h23-24,29-30H,8-22,25-26H2,1-7H3 |
| InChIKey | ITJMIOWDALZZMP-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.13 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|