C36H35NO2S3Si — CID 123579224
1-methyl-3-(10-methyl-7,7-diphenyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 123579224) has the molecular formula C36H35NO2S3Si and a molecular weight of 637.97 g/mol. Its IUPAC name is 1-methyl-3-(10-methyl-7,7-diphenyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1-methyl-3-(10-methyl-7,7-diphenyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 123579224 |
| Molecular Formula | C36H35NO2S3Si |
| Molecular Weight | 637.97 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | 1-methyl-3-(10-methyl-7,7-diphenyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-5-octylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2c(C)sc(-c3cc4c(s3)-c3sc(C)cc3[Si]4(c3ccccc3)c3ccccc3)c2C1=O |
| InChI | InChI=1S/C36H35NO2S3Si/c1-4-5-6-7-8-15-20-37-35(38)30-24(3)41-32(31(30)36(37)39)27-22-29-34(42-27)33-28(21-23(2)40-33)43(29,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h9-14,16-19,21-22H,4-8,15,20H2,1-3H3 |
| InChIKey | BMUJUXHXSFBNRA-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.97 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|