C22H19NO2S — CID 102432668
5-butyl-1,3-diphenylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 102432668) has the molecular formula C22H19NO2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 5-butyl-1,3-diphenylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-butyl-1,3-diphenylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 102432668 |
| Molecular Formula | C22H19NO2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-butyl-1,3-diphenylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCN1C(=O)c2c(-c3ccccc3)sc(-c3ccccc3)c2C1=O |
| InChI | InChI=1S/C22H19NO2S/c1-2-3-14-23-21(24)17-18(22(23)25)20(16-12-8-5-9-13-16)26-19(17)15-10-6-4-7-11-15/h4-13H,2-3,14H2,1H3 |
| InChIKey | HMGFULRECDOYET-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|