C21H19NO4 — CID 58822027
4-(1-butyl-2,5-dioxo-4-phenylpyrrol-3-yl)benzoic acid (PubChem CID 58822027) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-(1-butyl-2,5-dioxo-4-phenylpyrrol-3-yl)benzoic acid.
| Compound Name | 4-(1-butyl-2,5-dioxo-4-phenylpyrrol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 58822027 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-(1-butyl-2,5-dioxo-4-phenylpyrrol-3-yl)benzoic acid |
| SMILES | CCCCN1C(=O)C(c2ccccc2)=C(c2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C21H19NO4/c1-2-3-13-22-19(23)17(14-7-5-4-6-8-14)18(20(22)24)15-9-11-16(12-10-15)21(25)26/h4-12H,2-3,13H2,1H3,(H,25,26) |
| InChIKey | PEPRBVBMZUKQQP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|