C29H25NO4 — CID 118939053
2-butylbenzo[de]isoquinoline-1,3-dione;4-phenylbenzoic acid (PubChem CID 118939053) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-butylbenzo[de]isoquinoline-1,3-dione;4-phenylbenzoic acid.
| Compound Name | 2-butylbenzo[de]isoquinoline-1,3-dione;4-phenylbenzoic acid |
|---|---|
| PubChem CID | 118939053 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-butylbenzo[de]isoquinoline-1,3-dione;4-phenylbenzoic acid |
| SMILES | CCCCN1C(=O)c2cccc3cccc(c23)C1=O.O=C(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO2.C13H10O2/c1-2-3-10-17-15(18)12-8-4-6-11-7-5-9-13(14(11)12)16(17)19;14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h4-9H,2-3,10H2,1H3;1-9H,(H,14,15) |
| InChIKey | OAZMCKZKMYPTHB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|