C23H18N2O6 — CID 126001885
4-(2-butyl-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl)benzoic acid (PubChem CID 126001885) has the molecular formula C23H18N2O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-(2-butyl-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl)benzoic acid.
| Compound Name | 4-(2-butyl-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 126001885 |
| Molecular Formula | C23H18N2O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-(2-butyl-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl)benzoic acid |
| SMILES | CCCCN1C(=O)c2cccc3c(-c4ccc(C(=O)O)cc4)c([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C23H18N2O6/c1-2-3-11-24-21(26)16-6-4-5-15-19(13-7-9-14(10-8-13)23(28)29)18(25(30)31)12-17(20(15)16)22(24)27/h4-10,12H,2-3,11H2,1H3,(H,28,29) |
| InChIKey | LOAYAWSYAJAVKW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|