C16H15BrIN2O3- — CID 163785929
(6-bromo-2-butyl-1,3-dioxobenzo[de]isoquinolin-5-yl)-oxidoazanium iodide (PubChem CID 163785929) has the molecular formula C16H15BrIN2O3- and a molecular weight of 490.12 g/mol. Its IUPAC name is (6-bromo-2-butyl-1,3-dioxobenzo[de]isoquinolin-5-yl)-oxidoazanium iodide.
| Compound Name | (6-bromo-2-butyl-1,3-dioxobenzo[de]isoquinolin-5-yl)-oxidoazanium iodide |
|---|---|
| PubChem CID | 163785929 |
| Molecular Formula | C16H15BrIN2O3- |
| Molecular Weight | 490.12 g/mol |
| Exact Mass | 488.93 |
| IUPAC Name | (6-bromo-2-butyl-1,3-dioxobenzo[de]isoquinolin-5-yl)-oxidoazanium iodide |
| SMILES | CCCCN1C(=O)c2cccc3c(Br)c([NH2+][O-])cc(c23)C1=O.[I-] |
| InChI | InChI=1S/C16H15BrN2O3.HI/c1-2-3-7-19-15(20)10-6-4-5-9-13(10)11(16(19)21)8-12(18-22)14(9)17;/h4-6,8H,2-3,7,18H2,1H3;1H/p-1 |
| InChIKey | ORVSECGVNJIXLP-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|