C24H24Br2N2O4 — CID 44549418
2,3-dibromo-6,13-dipentyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 44549418) has the molecular formula C24H24Br2N2O4 and a molecular weight of 564.27 g/mol. Its IUPAC name is 2,3-dibromo-6,13-dipentyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,3-dibromo-6,13-dipentyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 44549418 |
| Molecular Formula | C24H24Br2N2O4 |
| Molecular Weight | 564.27 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | 2,3-dibromo-6,13-dipentyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCN1C(=O)c2ccc3c4c(c(Br)c(Br)c(c24)C1=O)C(=O)N(CCCCC)C3=O |
| InChI | InChI=1S/C24H24Br2N2O4/c1-3-5-7-11-27-21(29)13-9-10-14-16-15(13)17(23(27)31)19(25)20(26)18(16)24(32)28(22(14)30)12-8-6-4-2/h9-10H,3-8,11-12H2,1-2H3 |
| InChIKey | QZJQDRBMRUOFOS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|