C52H84Br2N2O4Si2 — CID 132992434
2,9-dibromo-6,13-bis[6-[dihexyl(methyl)silyl]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 132992434) has the molecular formula C52H84Br2N2O4Si2 and a molecular weight of 1017.23 g/mol. Its IUPAC name is 2,9-dibromo-6,13-bis[6-[dihexyl(methyl)silyl]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,9-dibromo-6,13-bis[6-[dihexyl(methyl)silyl]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 132992434 |
| Molecular Formula | C52H84Br2N2O4Si2 |
| Molecular Weight | 1017.23 g/mol |
| Exact Mass | 1014.43 |
| IUPAC Name | 2,9-dibromo-6,13-bis[6-[dihexyl(methyl)silyl]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCC[Si](C)(CCCCCC)CCCCCCN1C(=O)c2cc(Br)c3c4c(cc(Br)c(c24)C1=O)C(=O)N(CCCCCC[Si](C)(CCCCCC)CCCCCC)C3=O |
| InChI | InChI=1S/C52H84Br2N2O4Si2/c1-7-11-15-25-33-61(5,34-26-16-12-8-2)37-29-21-19-23-31-55-49(57)41-39-44(54)48-46-42(40-43(53)47(45(41)46)51(55)59)50(58)56(52(48)60)32-24-20-22-30-38-62(6,35-27-17-13-9-3)36-28-18-14-10-4/h39-40H,7-38H2,1-6H3 |
| InChIKey | LIJRZGMLDNOIFC-UHFFFAOYSA-N |
| XLogP | 17.16 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.23 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|