C15H19NO4 — CID 132502949
2-heptyl-4,6-dihydroxyisoindole-1,3-dione (PubChem CID 132502949) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-heptyl-4,6-dihydroxyisoindole-1,3-dione.
| Compound Name | 2-heptyl-4,6-dihydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 132502949 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-heptyl-4,6-dihydroxyisoindole-1,3-dione |
| SMILES | CCCCCCCN1C(=O)c2cc(O)cc(O)c2C1=O |
| InChI | InChI=1S/C15H19NO4/c1-2-3-4-5-6-7-16-14(19)11-8-10(17)9-12(18)13(11)15(16)20/h8-9,17-18H,2-7H2,1H3 |
| InChIKey | MEQDPTUKAHKORV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|