C54H90N2O4Sn2 — CID 134957016
6,13-dioctyl-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 134957016) has the molecular formula C54H90N2O4Sn2 and a molecular weight of 1068.75 g/mol. Its IUPAC name is 6,13-dioctyl-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dioctyl-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 134957016 |
| Molecular Formula | C54H90N2O4Sn2 |
| Molecular Weight | 1068.75 g/mol |
| Exact Mass | 1070.49 |
| IUPAC Name | 6,13-dioctyl-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCCCCN1C(=O)c2cc([Sn](CCCC)(CCCC)CCCC)c3c4c(cc([Sn](CCCC)(CCCC)CCCC)c(c24)C1=O)C(=O)N(CCCCCCCC)C3=O |
| InChI | InChI=1S/C30H36N2O4.6C4H9.2Sn/c1-3-5-7-9-11-13-19-31-27(33)21-15-17-23-26-24(18-16-22(25(21)26)28(31)34)30(36)32(29(23)35)20-14-12-10-8-6-4-2;6*1-3-4-2;;/h15,18H,3-14,19-20H2,1-2H3;6*1,3-4H2,2H3;; |
| InChIKey | WOJXUQUDCXAFLA-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1068.75 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|