C39H58N2O4Sn — CID 159912874
6,13-dihexyl-2-methyl-9-tributylstannyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 159912874) has the molecular formula C39H58N2O4Sn and a molecular weight of 737.61 g/mol. Its IUPAC name is 6,13-dihexyl-2-methyl-9-tributylstannyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dihexyl-2-methyl-9-tributylstannyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 159912874 |
| Molecular Formula | C39H58N2O4Sn |
| Molecular Weight | 737.61 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | 6,13-dihexyl-2-methyl-9-tributylstannyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCCN1C(=O)c2cc([Sn](CCCC)(CCCC)CCCC)c3c4c(cc(C)c(c24)C1=O)C(=O)N(CCCCCC)C3=O |
| InChI | InChI=1S/C27H31N2O4.3C4H9.Sn/c1-4-6-8-10-14-28-24(30)18-12-13-19-23-21(17(3)16-20(22(18)23)26(28)32)27(33)29(25(19)31)15-11-9-7-5-2;3*1-3-4-2;/h13,16H,4-11,14-15H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | WAOSXMLWGWMQEU-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.61 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|