C62H90N2O4Sn2 — CID 177470592
6,13-bis[2,6-di(propan-2-yl)phenyl]-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 177470592) has the molecular formula C62H90N2O4Sn2 and a molecular weight of 1164.83 g/mol. Its IUPAC name is 6,13-bis[2,6-di(propan-2-yl)phenyl]-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[2,6-di(propan-2-yl)phenyl]-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 177470592 |
| Molecular Formula | C62H90N2O4Sn2 |
| Molecular Weight | 1164.83 g/mol |
| Exact Mass | 1166.49 |
| IUPAC Name | 6,13-bis[2,6-di(propan-2-yl)phenyl]-2,9-bis(tributylstannyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc2c3c(c([Sn](CCCC)(CCCC)CCCC)cc4c3c1C(=O)N(c1c(C(C)C)cccc1C(C)C)C4=O)C(=O)N(c1c(C(C)C)cccc1C(C)C)C2=O |
| InChI | InChI=1S/C38H36N2O4.6C4H9.2Sn/c1-19(2)23-11-9-12-24(20(3)4)33(23)39-35(41)27-15-17-29-32-30(18-16-28(31(27)32)36(39)42)38(44)40(37(29)43)34-25(21(5)6)13-10-14-26(34)22(7)8;6*1-3-4-2;;/h9-15,18-22H,1-8H3;6*1,3-4H2,2H3;; |
| InChIKey | LEPVVENZJCYVAZ-UHFFFAOYSA-N |
| XLogP | 17.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.83 |
| LogP ≤ 5 | 17.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|