C50H42N2O4S4 — CID 132511783
7-[2,6-di(propan-2-yl)phenyl]-2-[7-[2,6-di(propan-2-yl)phenyl]-6,8-dioxo-[1,3]benzodithiolo[6,5-f]isoindol-2-ylidene]-[1,3]benzodithiolo[6,5-f]isoindole-6,8-dione (PubChem CID 132511783) has the molecular formula C50H42N2O4S4 and a molecular weight of 863.16 g/mol. Its IUPAC name is 7-[2,6-di(propan-2-yl)phenyl]-2-[7-[2,6-di(propan-2-yl)phenyl]-6,8-dioxo-[1,3]benzodithiolo[6,5-f]isoindol-2-ylidene]-[1,3]benzodithiolo[6,5-f]isoindole-6,8-dione.
| Compound Name | 7-[2,6-di(propan-2-yl)phenyl]-2-[7-[2,6-di(propan-2-yl)phenyl]-6,8-dioxo-[1,3]benzodithiolo[6,5-f]isoindol-2-ylidene]-[1,3]benzodithiolo[6,5-f]isoindole-6,8-dione |
|---|---|
| PubChem CID | 132511783 |
| Molecular Formula | C50H42N2O4S4 |
| Molecular Weight | 863.16 g/mol |
| Exact Mass | 862.20 |
| IUPAC Name | 7-[2,6-di(propan-2-yl)phenyl]-2-[7-[2,6-di(propan-2-yl)phenyl]-6,8-dioxo-[1,3]benzodithiolo[6,5-f]isoindol-2-ylidene]-[1,3]benzodithiolo[6,5-f]isoindole-6,8-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cc3cc4c(cc3cc2C1=O)SC(=C1Sc2cc3cc5c(cc3cc2S1)C(=O)N(c1c(C(C)C)cccc1C(C)C)C5=O)S4 |
| InChI | InChI=1S/C50H42N2O4S4/c1-23(2)31-11-9-12-32(24(3)4)43(31)51-45(53)35-15-27-19-39-40(20-28(27)16-36(35)46(51)54)58-49(57-39)50-59-41-21-29-17-37-38(18-30(29)22-42(41)60-50)48(56)52(47(37)55)44-33(25(5)6)13-10-14-34(44)26(7)8/h9-26H,1-8H3 |
| InChIKey | FHVNBKMIASIYKC-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.16 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|