C44H35N3O2 — CID 121247998
5,6-di(carbazol-9-yl)-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 121247998) has the molecular formula C44H35N3O2 and a molecular weight of 637.78 g/mol. Its IUPAC name is 5,6-di(carbazol-9-yl)-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 5,6-di(carbazol-9-yl)-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 121247998 |
| Molecular Formula | C44H35N3O2 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | 5,6-di(carbazol-9-yl)-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cc(-n3c4ccccc4c4ccccc43)c(-n3c4ccccc4c4ccccc43)cc2C1=O |
| InChI | InChI=1S/C44H35N3O2/c1-26(2)28-18-13-19-29(27(3)4)42(28)47-43(48)34-24-40(45-36-20-9-5-14-30(36)31-15-6-10-21-37(31)45)41(25-35(34)44(47)49)46-38-22-11-7-16-32(38)33-17-8-12-23-39(33)46/h5-27H,1-4H3 |
| InChIKey | OLOXOBABZHFPCV-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|