C46H48N3O2 — CID 172510862
CID 172510862 (PubChem CID 172510862) has the molecular formula C46H48N3O2 and a molecular weight of 674.91 g/mol.
| Compound Name | CID 172510862 |
|---|---|
| PubChem CID | 172510862 |
| Molecular Formula | C46H48N3O2 |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C](c2ccc3c(c2)c2ccccc2n3-c2ccccc2)N(c2c(C(C)C)cccc2C(C)C)C(=O)CC1=O |
| InChI | InChI=1S/C46H48N3O2/c1-28(2)34-19-14-20-35(29(3)4)44(34)48-42(50)27-43(51)49(45-36(30(5)6)21-15-22-37(45)31(7)8)46(48)32-24-25-41-39(26-32)38-18-12-13-23-40(38)47(41)33-16-10-9-11-17-33/h9-26,28-31H,27H2,1-8H3 |
| InChIKey | VJFIKEBOUPBUNL-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|