C38H43N2 — CID 172510888
CID 172510888 (PubChem CID 172510888) has the molecular formula C38H43N2 and a molecular weight of 527.78 g/mol.
| Compound Name | CID 172510888 |
|---|---|
| PubChem CID | 172510888 |
| Molecular Formula | C38H43N2 |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C](c2ccc3c(c2)c2ccccc2n3-c2ccccc2)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C38H43N2/c1-25(2)29-18-14-19-30(26(3)4)35(29)40-36(37(5,6)24-38(40,7)8)27-21-22-34-32(23-27)31-17-12-13-20-33(31)39(34)28-15-10-9-11-16-28/h9-23,25-26H,24H2,1-8H3 |
| InChIKey | UKTAUTHNTVMSGG-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |