C32H28N2O2S — CID 121248016
2-[2,6-di(propan-2-yl)phenyl]-5-phenothiazin-10-ylisoindole-1,3-dione (PubChem CID 121248016) has the molecular formula C32H28N2O2S and a molecular weight of 504.66 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-5-phenothiazin-10-ylisoindole-1,3-dione.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-5-phenothiazin-10-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 121248016 |
| Molecular Formula | C32H28N2O2S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-5-phenothiazin-10-ylisoindole-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2ccc(N3c4ccccc4Sc4ccccc43)cc2C1=O |
| InChI | InChI=1S/C32H28N2O2S/c1-19(2)22-10-9-11-23(20(3)4)30(22)34-31(35)24-17-16-21(18-25(24)32(34)36)33-26-12-5-7-14-28(26)37-29-15-8-6-13-27(29)33/h5-20H,1-4H3 |
| InChIKey | CFMCRVSRJLMDPF-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|