C21H24N2O4 — CID 173421133
azane;2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylic acid (PubChem CID 173421133) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is azane;2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylic acid.
| Compound Name | azane;2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 173421133 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | azane;2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cccc(C(=O)O)c2C1=O.N |
| InChI | InChI=1S/C21H21NO4.H3N/c1-11(2)13-7-5-8-14(12(3)4)18(13)22-19(23)15-9-6-10-16(21(25)26)17(15)20(22)24;/h5-12H,1-4H3,(H,25,26);1H3 |
| InChIKey | OYVUDHFJGYHTOV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|