C24H28N2O4 — CID 70493369
ethyl N-[2-[2,6-di(propan-2-yl)phenyl]-5-methyl-1,3-dioxoisoindol-4-yl]carbamate (PubChem CID 70493369) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl N-[2-[2,6-di(propan-2-yl)phenyl]-5-methyl-1,3-dioxoisoindol-4-yl]carbamate.
| Compound Name | ethyl N-[2-[2,6-di(propan-2-yl)phenyl]-5-methyl-1,3-dioxoisoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 70493369 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | ethyl N-[2-[2,6-di(propan-2-yl)phenyl]-5-methyl-1,3-dioxoisoindol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1c(C)ccc2c1C(=O)N(c1c(C(C)C)cccc1C(C)C)C2=O |
| InChI | InChI=1S/C24H28N2O4/c1-7-30-24(29)25-20-15(6)11-12-18-19(20)23(28)26(22(18)27)21-16(13(2)3)9-8-10-17(21)14(4)5/h8-14H,7H2,1-6H3,(H,25,29) |
| InChIKey | RHLFNWIDHWPFBL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|