C21H21NO4 — CID 70493545
1,3-dioxo-2-(2-propan-2-yl-6-propylphenyl)isoindole-4-carboxylic acid (PubChem CID 70493545) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1,3-dioxo-2-(2-propan-2-yl-6-propylphenyl)isoindole-4-carboxylic acid.
| Compound Name | 1,3-dioxo-2-(2-propan-2-yl-6-propylphenyl)isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 70493545 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1,3-dioxo-2-(2-propan-2-yl-6-propylphenyl)isoindole-4-carboxylic acid |
| SMILES | CCCc1cccc(C(C)C)c1N1C(=O)c2cccc(C(=O)O)c2C1=O |
| InChI | InChI=1S/C21H21NO4/c1-4-7-13-8-5-9-14(12(2)3)18(13)22-19(23)15-10-6-11-16(21(25)26)17(15)20(22)24/h5-6,8-12H,4,7H2,1-3H3,(H,25,26) |
| InChIKey | NRWNLRSHZVUYHH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|