About 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide
1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide (PubChem CID 172751409) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide |
| PubChem CID | 172751409 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide |
| SMILES | CCCc1cccc(C(C)C)c1C(C)C.OO |
| InChI | InChI=1S/C15H24.H2O2/c1-6-8-13-9-7-10-14(11(2)3)15(13)12(4)5;1-2/h7,9-12H,6,8H2,1-5H3;1-2H |
| InChIKey | KKRBGEAIXDTZHA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide?
The IUPAC name of 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide (CID 172751409) is 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide.
What is the SMILES notation for 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide?
The canonical SMILES for 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide is CCCc1cccc(C(C)C)c1C(C)C.OO.
What is the InChIKey of 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide?
The InChIKey is KKRBGEAIXDTZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.H2O2/c1-6-8-13-9-7-10-14(11(2)3)15(13)12(4)5;1-2/h7,9-12H,6,8H2,1-5H3;1-2H.
What are the key properties of 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide?
1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide has a molecular weight of 238.37 g/mol, XLogP of 4.90, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)-3-propylbenzene;hydrogen peroxide is sourced from PubChem (CID 172751409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).