C14H21NS — CID 173093562
N-[[2,3-di(propan-2-yl)phenyl]methyl]methanethioamide (PubChem CID 173093562) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is N-[[2,3-di(propan-2-yl)phenyl]methyl]methanethioamide.
| Compound Name | N-[[2,3-di(propan-2-yl)phenyl]methyl]methanethioamide |
|---|---|
| PubChem CID | 173093562 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[[2,3-di(propan-2-yl)phenyl]methyl]methanethioamide |
| SMILES | CC(C)c1cccc(CNC=S)c1C(C)C |
| InChI | InChI=1S/C14H21NS/c1-10(2)13-7-5-6-12(8-15-9-16)14(13)11(3)4/h5-7,9-11H,8H2,1-4H3,(H,15,16) |
| InChIKey | VHWMECOQNKBWQA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|