C15H24Cl2O2S — CID 22723821
sulfuryl dichloride;1,2,3-tri(propan-2-yl)benzene (PubChem CID 22723821) has the molecular formula C15H24Cl2O2S and a molecular weight of 339.33 g/mol. Its IUPAC name is sulfuryl dichloride;1,2,3-tri(propan-2-yl)benzene.
| Compound Name | sulfuryl dichloride;1,2,3-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 22723821 |
| Molecular Formula | C15H24Cl2O2S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | sulfuryl dichloride;1,2,3-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1C(C)C.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C15H24.Cl2O2S/c1-10(2)13-8-7-9-14(11(3)4)15(13)12(5)6;1-5(2,3)4/h7-12H,1-6H3; |
| InChIKey | DAUQESPJUCXKFM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |