About 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride
1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride (PubChem CID 90072599) has the molecular formula C21H28AuCl
and a molecular weight of 512.88 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride |
| PubChem CID | 90072599 |
| Molecular Formula | C21H28AuCl |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride |
| SMILES | CC(C)c1ccccc1-c1cccc(C(C)C)c1C(C)C.[Au+].[Cl-] |
| InChI | InChI=1S/C21H28.Au.ClH/c1-14(2)17-10-7-8-11-19(17)20-13-9-12-18(15(3)4)21(20)16(5)6;;/h7-16H,1-6H3;;1H/q;+1;/p-1 |
| InChIKey | MOLLOPULVVRKDL-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride?
The IUPAC name of 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride (CID 90072599) is 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride.
What is the SMILES notation for 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride?
The canonical SMILES for 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride is CC(C)c1ccccc1-c1cccc(C(C)C)c1C(C)C.[Au+].[Cl-].
What is the InChIKey of 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride?
The InChIKey is MOLLOPULVVRKDL-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H28.Au.ClH/c1-14(2)17-10-7-8-11-19(17)20-13-9-12-18(15(3)4)21(20)16(5)6;;/h7-16H,1-6H3;;1H/q;+1;/p-1.
What are the key properties of 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride?
1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride has a molecular weight of 512.88 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)-3-(2-propan-2-ylphenyl)benzene;gold(1+);chloride is sourced from PubChem (CID 90072599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).