C16H26 — CID 58827360
1-tert-butyl-2,3-di(propan-2-yl)benzene (PubChem CID 58827360) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-tert-butyl-2,3-di(propan-2-yl)benzene.
| Compound Name | 1-tert-butyl-2,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 58827360 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-tert-butyl-2,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)(C)C)c1C(C)C |
| InChI | InChI=1S/C16H26/c1-11(2)13-9-8-10-14(16(5,6)7)15(13)12(3)4/h8-12H,1-7H3 |
| InChIKey | KZWCMTJEILHZSF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |