About 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene
1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene (PubChem CID 141059308) has the molecular formula C24H34O4
and a molecular weight of 386.53 g/mol. Its IUPAC name is 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene |
| PubChem CID | 141059308 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(OOOOc2cccc(C(C)C)c2C(C)C)c1C(C)C |
| InChI | InChI=1S/C24H34O4/c1-15(2)19-11-9-13-21(23(19)17(5)6)25-27-28-26-22-14-10-12-20(16(3)4)24(22)18(7)8/h9-18H,1-8H3 |
| InChIKey | AOPYHHXGYLKFMH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene?
The IUPAC name of 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene (CID 141059308) is 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene.
What is the SMILES notation for 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene?
The canonical SMILES for 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene is CC(C)c1cccc(OOOOc2cccc(C(C)C)c2C(C)C)c1C(C)C.
What is the InChIKey of 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene?
The InChIKey is AOPYHHXGYLKFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O4/c1-15(2)19-11-9-13-21(23(19)17(5)6)25-27-28-26-22-14-10-12-20(16(3)4)24(22)18(7)8/h9-18H,1-8H3.
What are the key properties of 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene?
1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene has a molecular weight of 386.53 g/mol, XLogP of 7.42, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,3-di(propan-2-yl)phenyl]peroxyperoxy-2,3-di(propan-2-yl)benzene is sourced from PubChem (CID 141059308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).