C30H39O3P — CID 118862449
1-[[2,3-di(propan-2-yl)phenoxy]-phenylphosphoryl]oxy-2,3-di(propan-2-yl)benzene (PubChem CID 118862449) has the molecular formula C30H39O3P and a molecular weight of 478.61 g/mol. Its IUPAC name is 1-[[2,3-di(propan-2-yl)phenoxy]-phenylphosphoryl]oxy-2,3-di(propan-2-yl)benzene.
| Compound Name | 1-[[2,3-di(propan-2-yl)phenoxy]-phenylphosphoryl]oxy-2,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 118862449 |
| Molecular Formula | C30H39O3P |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-[[2,3-di(propan-2-yl)phenoxy]-phenylphosphoryl]oxy-2,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(OP(=O)(Oc2cccc(C(C)C)c2C(C)C)c2ccccc2)c1C(C)C |
| InChI | InChI=1S/C30H39O3P/c1-20(2)25-16-12-18-27(29(25)22(5)6)32-34(31,24-14-10-9-11-15-24)33-28-19-13-17-26(21(3)4)30(28)23(7)8/h9-23H,1-8H3 |
| InChIKey | SPKBXTCLIUIOTF-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|