chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid

C12H18ClO3P — CID 151663674

IUPACchloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid
SMILESCC(C)c1cccc(OP(=O)(O)Cl)c1C(C)C
InChIInChI=1S/C12H18ClO3P/c1-8(2)10-6-5-7-11(12(10)9(3)4)16-17(13,14)15/h5-9H,1-4H3,(H,14,15)
InChIKeyQXBLXGYAGZNSAI-UHFFFAOYSA-N
MW276.70 g/mol
LogP4.65
Rot. Bonds4

About chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid

chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid (PubChem CID 151663674) has the molecular formula C12H18ClO3P and a molecular weight of 276.70 g/mol. Its IUPAC name is chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid.

Molecular Properties

Compound Namechloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid
PubChem CID151663674
Molecular FormulaC12H18ClO3P
Molecular Weight276.70 g/mol
Exact Mass276.07
IUPAC Namechloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid
SMILESCC(C)c1cccc(OP(=O)(O)Cl)c1C(C)C
InChIInChI=1S/C12H18ClO3P/c1-8(2)10-6-5-7-11(12(10)9(3)4)16-17(13,14)15/h5-9H,1-4H3,(H,14,15)
InChIKeyQXBLXGYAGZNSAI-UHFFFAOYSA-N
XLogP4.65
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.70
LogP ≤ 54.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid?
The IUPAC name of chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid (CID 151663674) is chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid.
What is the SMILES notation for chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid?
The canonical SMILES for chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid is CC(C)c1cccc(OP(=O)(O)Cl)c1C(C)C.
What is the InChIKey of chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid?
The InChIKey is QXBLXGYAGZNSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClO3P/c1-8(2)10-6-5-7-11(12(10)9(3)4)16-17(13,14)15/h5-9H,1-4H3,(H,14,15).
What are the key properties of chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid?
chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid has a molecular weight of 276.70 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[2,3-di(propan-2-yl)phenoxy]phosphinic acid is sourced from PubChem (CID 151663674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).