C10H15O5P — CID 141133004
(2-propan-2-ylphenoxy)methyl dihydrogen phosphate (PubChem CID 141133004) has the molecular formula C10H15O5P and a molecular weight of 246.20 g/mol. Its IUPAC name is (2-propan-2-ylphenoxy)methyl dihydrogen phosphate.
| Compound Name | (2-propan-2-ylphenoxy)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 141133004 |
| Molecular Formula | C10H15O5P |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (2-propan-2-ylphenoxy)methyl dihydrogen phosphate |
| SMILES | CC(C)c1ccccc1OCOP(=O)(O)O |
| InChI | InChI=1S/C10H15O5P/c1-8(2)9-5-3-4-6-10(9)14-7-15-16(11,12)13/h3-6,8H,7H2,1-2H3,(H2,11,12,13) |
| InChIKey | IKIIRNUXUCJILW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|