C14H23O6P — CID 69301225
[2-[2,6-di(propan-2-yl)phenoxy]-2-hydroxyethyl] dihydrogen phosphate (PubChem CID 69301225) has the molecular formula C14H23O6P and a molecular weight of 318.31 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)phenoxy]-2-hydroxyethyl] dihydrogen phosphate.
| Compound Name | [2-[2,6-di(propan-2-yl)phenoxy]-2-hydroxyethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69301225 |
| Molecular Formula | C14H23O6P |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)phenoxy]-2-hydroxyethyl] dihydrogen phosphate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(O)COP(=O)(O)O |
| InChI | InChI=1S/C14H23O6P/c1-9(2)11-6-5-7-12(10(3)4)14(11)20-13(15)8-19-21(16,17)18/h5-7,9-10,13,15H,8H2,1-4H3,(H2,16,17,18) |
| InChIKey | HGWHJZJQVSGLKI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|