C12H17Cl2O2P — CID 14943982
2-dichlorophosphoryloxy-1,3-di(propan-2-yl)benzene (PubChem CID 14943982) has the molecular formula C12H17Cl2O2P and a molecular weight of 295.15 g/mol. Its IUPAC name is 2-dichlorophosphoryloxy-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-dichlorophosphoryloxy-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 14943982 |
| Molecular Formula | C12H17Cl2O2P |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-dichlorophosphoryloxy-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1OP(=O)(Cl)Cl |
| InChI | InChI=1S/C12H17Cl2O2P/c1-8(2)10-6-5-7-11(9(3)4)12(10)16-17(13,14)15/h5-9H,1-4H3 |
| InChIKey | HZKNZDIPZLLDOH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|