About [2,6-di(propan-2-yl)phenyl] formate
[2,6-di(propan-2-yl)phenyl] formate (PubChem CID 54331720) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] formate.
Molecular Properties
| Compound Name | [2,6-di(propan-2-yl)phenyl] formate |
| PubChem CID | 54331720 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] formate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC=O |
| InChI | InChI=1S/C13H18O2/c1-9(2)11-6-5-7-12(10(3)4)13(11)15-8-14/h5-10H,1-4H3 |
| InChIKey | SYUQKMKGNXAVFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2,6-di(propan-2-yl)phenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-di(propan-2-yl)phenyl] formate?
The IUPAC name of [2,6-di(propan-2-yl)phenyl] formate (CID 54331720) is [2,6-di(propan-2-yl)phenyl] formate.
What is the SMILES notation for [2,6-di(propan-2-yl)phenyl] formate?
The canonical SMILES for [2,6-di(propan-2-yl)phenyl] formate is CC(C)c1cccc(C(C)C)c1OC=O.
What is the InChIKey of [2,6-di(propan-2-yl)phenyl] formate?
The InChIKey is SYUQKMKGNXAVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-9(2)11-6-5-7-12(10(3)4)13(11)15-8-14/h5-10H,1-4H3.
What are the key properties of [2,6-di(propan-2-yl)phenyl] formate?
[2,6-di(propan-2-yl)phenyl] formate has a molecular weight of 206.28 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-di(propan-2-yl)phenyl] formate is sourced from PubChem (CID 54331720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).