C13H18O2 — CID 54331720
[2,6-di(propan-2-yl)phenyl] formate (PubChem CID 54331720) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] formate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] formate |
|---|---|
| PubChem CID | 54331720 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] formate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC=O |
| InChI | InChI=1S/C13H18O2/c1-9(2)11-6-5-7-12(10(3)4)13(11)15-8-14/h5-10H,1-4H3 |
| InChIKey | SYUQKMKGNXAVFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|