C21H30O4 — CID 87880961
1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-hydroperoxy-4-propan-2-ylbenzene (PubChem CID 87880961) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-hydroperoxy-4-propan-2-ylbenzene.
| Compound Name | 1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-hydroperoxy-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 87880961 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-hydroperoxy-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(OO)cc1.CC(C)c1cccc(OO)c1C(C)C |
| InChI | InChI=1S/C12H18O2.C9H12O2/c1-8(2)10-6-5-7-11(14-13)12(10)9(3)4;1-7(2)8-3-5-9(11-10)6-4-8/h5-9,13H,1-4H3;3-7,10H,1-2H3 |
| InChIKey | SEKXVASOWNFSPN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|