C24H36O4 — CID 88802356
1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-(hydroperoxymethyl)-2,3-dimethyl-4-propan-2-ylbenzene (PubChem CID 88802356) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-(hydroperoxymethyl)-2,3-dimethyl-4-propan-2-ylbenzene.
| Compound Name | 1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-(hydroperoxymethyl)-2,3-dimethyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 88802356 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-hydroperoxy-2,3-di(propan-2-yl)benzene;1-(hydroperoxymethyl)-2,3-dimethyl-4-propan-2-ylbenzene |
| SMILES | CC(C)c1cccc(OO)c1C(C)C.Cc1c(COO)ccc(C(C)C)c1C |
| InChI | InChI=1S/2C12H18O2/c1-8(2)12-6-5-11(7-14-13)9(3)10(12)4;1-8(2)10-6-5-7-11(14-13)12(10)9(3)4/h5-6,8,13H,7H2,1-4H3;5-9,13H,1-4H3 |
| InChIKey | PEAZILHSDUBCRG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|