C13H20 — CID 145053588
1-ethyl-2,3-dimethyl-4-propan-2-ylbenzene (PubChem CID 145053588) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-4-propan-2-ylbenzene.
| Compound Name | 1-ethyl-2,3-dimethyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 145053588 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-4-propan-2-ylbenzene |
| SMILES | CCc1ccc(C(C)C)c(C)c1C |
| InChI | InChI=1S/C13H20/c1-6-12-7-8-13(9(2)3)11(5)10(12)4/h7-9H,6H2,1-5H3 |
| InChIKey | AARYVCVZQZFKCP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |