C17H30N2 — CID 143623031
ethene;1-(4-ethyl-2,3-dimethylphenyl)-N,N-dimethylethanamine;methanimine (PubChem CID 143623031) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is ethene;1-(4-ethyl-2,3-dimethylphenyl)-N,N-dimethylethanamine;methanimine.
| Compound Name | ethene;1-(4-ethyl-2,3-dimethylphenyl)-N,N-dimethylethanamine;methanimine |
|---|---|
| PubChem CID | 143623031 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | ethene;1-(4-ethyl-2,3-dimethylphenyl)-N,N-dimethylethanamine;methanimine |
| SMILES | C=C.CCc1ccc(C(C)N(C)C)c(C)c1C.[H]N=C |
| InChI | InChI=1S/C14H23N.C2H4.CH3N/c1-7-13-8-9-14(11(3)10(13)2)12(4)15(5)6;2*1-2/h8-9,12H,7H2,1-6H3;1-2H2;2H,1H2 |
| InChIKey | LAASXCBTJOVOGX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|